C25H31N3O4 — CID 155170068
3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]benzonitrile (PubChem CID 155170068) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]benzonitrile.
| Compound Name | 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 155170068 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]benzonitrile |
| SMILES | CCCCCOc1cc(N2CCCN(Cc3ccc(C#N)cc3OC)C2=O)ccc1OC |
| InChI | InChI=1S/C25H31N3O4/c1-4-5-6-14-32-24-16-21(10-11-22(24)30-2)28-13-7-12-27(25(28)29)18-20-9-8-19(17-26)15-23(20)31-3/h8-11,15-16H,4-7,12-14,18H2,1-3H3 |
| InChIKey | SEXYWUQMYQXCTM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|