C13H17FN2O4 — CID 155171165
(2R)-2-[[(3R)-2-amino-3-hydroxybutanoyl]amino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 155171165) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is (2R)-2-[[(3R)-2-amino-3-hydroxybutanoyl]amino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | (2R)-2-[[(3R)-2-amino-3-hydroxybutanoyl]amino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 155171165 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2R)-2-[[(3R)-2-amino-3-hydroxybutanoyl]amino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | C[C@@H](O)C(N)C(=O)N[C@H](Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C13H17FN2O4/c1-7(17)11(15)12(18)16-10(13(19)20)6-8-2-4-9(14)5-3-8/h2-5,7,10-11,17H,6,15H2,1H3,(H,16,18)(H,19,20)/t7-,10-,11?/m1/s1 |
| InChIKey | STTQQEAYEVHJFM-LSLVDHONSA-N |
| XLogP | -0.35 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |