C61H38N4O4 — CID 155171626
2-[9,9-bis(4-nitrophenyl)-7-(9-phenylcarbazol-2-yl)fluoren-2-yl]-9-phenylcarbazole (PubChem CID 155171626) has the molecular formula C61H38N4O4 and a molecular weight of 891.00 g/mol. Its IUPAC name is 2-[9,9-bis(4-nitrophenyl)-7-(9-phenylcarbazol-2-yl)fluoren-2-yl]-9-phenylcarbazole.
| Compound Name | 2-[9,9-bis(4-nitrophenyl)-7-(9-phenylcarbazol-2-yl)fluoren-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 155171626 |
| Molecular Formula | C61H38N4O4 |
| Molecular Weight | 891.00 g/mol |
| Exact Mass | 890.29 |
| IUPAC Name | 2-[9,9-bis(4-nitrophenyl)-7-(9-phenylcarbazol-2-yl)fluoren-2-yl]-9-phenylcarbazole |
| SMILES | O=[N+]([O-])c1ccc(C2(c3ccc([N+](=O)[O-])cc3)c3cc(-c4ccc5c6ccccc6n(-c6ccccc6)c5c4)ccc3-c3ccc(-c4ccc5c6ccccc6n(-c6ccccc6)c5c4)cc32)cc1 |
| InChI | InChI=1S/C61H38N4O4/c66-64(67)47-27-23-43(24-28-47)61(44-25-29-48(30-26-44)65(68)69)55-35-39(41-21-33-53-51-15-7-9-17-57(51)62(59(53)37-41)45-11-3-1-4-12-45)19-31-49(55)50-32-20-40(36-56(50)61)42-22-34-54-52-16-8-10-18-58(52)63(60(54)38-42)46-13-5-2-6-14-46/h1-38H |
| InChIKey | IBWJIKQAYIKFOX-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 96.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.00 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|