C18H29N — CID 155174105
12-methylidene-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12a-hexadecahydro-1H-naphtho[2,3-g]quinoline (PubChem CID 155174105) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 12-methylidene-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12a-hexadecahydro-1H-naphtho[2,3-g]quinoline.
| Compound Name | 12-methylidene-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12a-hexadecahydro-1H-naphtho[2,3-g]quinoline |
|---|---|
| PubChem CID | 155174105 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 12-methylidene-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11,11a,12a-hexadecahydro-1H-naphtho[2,3-g]quinoline |
| SMILES | C=C1C2CC3CCCCC3CC2CC2CCCNC12 |
| InChI | InChI=1S/C18H29N/c1-12-17-11-14-6-3-2-5-13(14)9-16(17)10-15-7-4-8-19-18(12)15/h13-19H,1-11H2 |
| InChIKey | GYPMJDMDOHXGNR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|