C22H27ClFN3O6S — CID 155174354
carbamoyl 2-[[4-chloro-3-(1-hydroxyethyl)-2-methoxyphenyl]sulfonylamino]-3-(6-fluoro-2,3-dimethylphenyl)butanimidate (PubChem CID 155174354) has the molecular formula C22H27ClFN3O6S and a molecular weight of 515.99 g/mol. Its IUPAC name is carbamoyl 2-[[4-chloro-3-(1-hydroxyethyl)-2-methoxyphenyl]sulfonylamino]-3-(6-fluoro-2,3-dimethylphenyl)butanimidate.
| Compound Name | carbamoyl 2-[[4-chloro-3-(1-hydroxyethyl)-2-methoxyphenyl]sulfonylamino]-3-(6-fluoro-2,3-dimethylphenyl)butanimidate |
|---|---|
| PubChem CID | 155174354 |
| Molecular Formula | C22H27ClFN3O6S |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | carbamoyl 2-[[4-chloro-3-(1-hydroxyethyl)-2-methoxyphenyl]sulfonylamino]-3-(6-fluoro-2,3-dimethylphenyl)butanimidate |
| SMILES | [H]/N=C(\OC(N)=O)C(NS(=O)(=O)c1ccc(Cl)c(C(C)O)c1OC)C(C)c1c(F)ccc(C)c1C |
| InChI | InChI=1S/C22H27ClFN3O6S/c1-10-6-8-15(24)17(11(10)2)12(3)19(21(25)33-22(26)29)27-34(30,31)16-9-7-14(23)18(13(4)28)20(16)32-5/h6-9,12-13,19,25,27-28H,1-5H3,(H2,26,29)/b25-21- |
| InChIKey | PTBKCFNOMNXLJR-DAFNUICNSA-N |
| XLogP | 3.68 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|