C25H27ClFN5O6S — CID 155453212
methyl (1Z,2S,3R)-2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-3-[6-fluoro-3-(2-methoxypyrimidin-5-yl)-2-methylphenyl]-N-formylbutanehydrazonate (PubChem CID 155453212) has the molecular formula C25H27ClFN5O6S and a molecular weight of 580.04 g/mol. Its IUPAC name is methyl (1Z,2S,3R)-2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-3-[6-fluoro-3-(2-methoxypyrimidin-5-yl)-2-methylphenyl]-N-formylbutanehydrazonate.
| Compound Name | methyl (1Z,2S,3R)-2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-3-[6-fluoro-3-(2-methoxypyrimidin-5-yl)-2-methylphenyl]-N-formylbutanehydrazonate |
|---|---|
| PubChem CID | 155453212 |
| Molecular Formula | C25H27ClFN5O6S |
| Molecular Weight | 580.04 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | methyl (1Z,2S,3R)-2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-3-[6-fluoro-3-(2-methoxypyrimidin-5-yl)-2-methylphenyl]-N-formylbutanehydrazonate |
| SMILES | CO/C(=N\NC=O)[C@@H](NS(=O)(=O)c1ccc(Cl)cc1OC)[C@H](C)c1c(F)ccc(-c2cnc(OC)nc2)c1C |
| InChI | InChI=1S/C25H27ClFN5O6S/c1-14-18(16-11-28-25(38-5)29-12-16)7-8-19(27)22(14)15(2)23(24(37-4)31-30-13-33)32-39(34,35)21-9-6-17(26)10-20(21)36-3/h6-13,15,23,32H,1-5H3,(H,30,33)/b31-24-/t15-,23+/m1/s1 |
| InChIKey | PBAZNSPUAZADAF-NGULTRQFSA-N |
| XLogP | 3.42 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.04 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|