C19H22ClFN4O4S — CID 142600999
5-chloro-2-[[(2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)-1-hydrazinyl-1-oxobutan-2-yl]sulfamoyl]benzamide (PubChem CID 142600999) has the molecular formula C19H22ClFN4O4S and a molecular weight of 456.93 g/mol. Its IUPAC name is 5-chloro-2-[[(2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)-1-hydrazinyl-1-oxobutan-2-yl]sulfamoyl]benzamide.
| Compound Name | 5-chloro-2-[[(2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)-1-hydrazinyl-1-oxobutan-2-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 142600999 |
| Molecular Formula | C19H22ClFN4O4S |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 5-chloro-2-[[(2S,3R)-3-(6-fluoro-2,3-dimethylphenyl)-1-hydrazinyl-1-oxobutan-2-yl]sulfamoyl]benzamide |
| SMILES | Cc1ccc(F)c([C@@H](C)[C@H](NS(=O)(=O)c2ccc(Cl)cc2C(N)=O)C(=O)NN)c1C |
| InChI | InChI=1S/C19H22ClFN4O4S/c1-9-4-6-14(21)16(10(9)2)11(3)17(19(27)24-23)25-30(28,29)15-7-5-12(20)8-13(15)18(22)26/h4-8,11,17,25H,23H2,1-3H3,(H2,22,26)(H,24,27)/t11-,17+/m1/s1 |
| InChIKey | VSGOEIHAMODNEC-DIFFPNOSSA-N |
| XLogP | 1.64 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|