C20H23ClFN3O3S — CID 167519240
(2S)-2-(7-chloro-1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazin-2-yl)-3-(6-fluoro-2,3-dimethylphenyl)butanehydrazide (PubChem CID 167519240) has the molecular formula C20H23ClFN3O3S and a molecular weight of 439.94 g/mol. Its IUPAC name is (2S)-2-(7-chloro-1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazin-2-yl)-3-(6-fluoro-2,3-dimethylphenyl)butanehydrazide.
| Compound Name | (2S)-2-(7-chloro-1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazin-2-yl)-3-(6-fluoro-2,3-dimethylphenyl)butanehydrazide |
|---|---|
| PubChem CID | 167519240 |
| Molecular Formula | C20H23ClFN3O3S |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (2S)-2-(7-chloro-1,1-dioxo-3,4-dihydro-1λ6,2-benzothiazin-2-yl)-3-(6-fluoro-2,3-dimethylphenyl)butanehydrazide |
| SMILES | Cc1ccc(F)c(C(C)[C@@H](C(=O)NN)N2CCc3ccc(Cl)cc3S2(=O)=O)c1C |
| InChI | InChI=1S/C20H23ClFN3O3S/c1-11-4-7-16(22)18(12(11)2)13(3)19(20(26)24-23)25-9-8-14-5-6-15(21)10-17(14)29(25,27)28/h4-7,10,13,19H,8-9,23H2,1-3H3,(H,24,26)/t13?,19-/m0/s1 |
| InChIKey | VWODUEILVDTXSJ-YFKXAPIDSA-N |
| XLogP | 2.80 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|