C23H27ClFNO6S — CID 171096382
(2S)-2-[7-chloro-6-(2-hydroxypropan-2-yl)-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]-3-(6-fluoro-2,3-dimethylphenyl)butanoic acid (PubChem CID 171096382) has the molecular formula C23H27ClFNO6S and a molecular weight of 499.99 g/mol. Its IUPAC name is (2S)-2-[7-chloro-6-(2-hydroxypropan-2-yl)-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]-3-(6-fluoro-2,3-dimethylphenyl)butanoic acid.
| Compound Name | (2S)-2-[7-chloro-6-(2-hydroxypropan-2-yl)-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]-3-(6-fluoro-2,3-dimethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 171096382 |
| Molecular Formula | C23H27ClFNO6S |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | (2S)-2-[7-chloro-6-(2-hydroxypropan-2-yl)-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]-3-(6-fluoro-2,3-dimethylphenyl)butanoic acid |
| SMILES | Cc1ccc(F)c(C(C)[C@@H](C(=O)O)N2CCOc3c(ccc(Cl)c3C(C)(C)O)S2(=O)=O)c1C |
| InChI | InChI=1S/C23H27ClFNO6S/c1-12-6-8-16(25)18(13(12)2)14(3)20(22(27)28)26-10-11-32-21-17(33(26,30)31)9-7-15(24)19(21)23(4,5)29/h6-9,14,20,29H,10-11H2,1-5H3,(H,27,28)/t14?,20-/m0/s1 |
| InChIKey | NINHCKSOOXLGOE-LGTGAQBVSA-N |
| XLogP | 3.96 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |