C22H27N4O4PS — CID 155179951
2-N-(6-dimethylphosphoryl-2-methoxy-3-pyridinyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine (PubChem CID 155179951) has the molecular formula C22H27N4O4PS and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-N-(6-dimethylphosphoryl-2-methoxy-3-pyridinyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(6-dimethylphosphoryl-2-methoxy-3-pyridinyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 155179951 |
| Molecular Formula | C22H27N4O4PS |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-N-(6-dimethylphosphoryl-2-methoxy-3-pyridinyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine |
| SMILES | COc1nc(P(C)(C)=O)ccc1Nc1cc(Nc2ccccc2S(=O)(=O)C(C)C)ccn1 |
| InChI | InChI=1S/C22H27N4O4PS/c1-15(2)32(28,29)19-9-7-6-8-17(19)24-16-12-13-23-20(14-16)25-18-10-11-21(31(4,5)27)26-22(18)30-3/h6-15H,1-5H3,(H2,23,24,25) |
| InChIKey | JBFKMOXRPNEXRO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|