C23H28N3O4PS — CID 67053387
2-N-(4-dimethylphosphoryl-2-methoxyphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine (PubChem CID 67053387) has the molecular formula C23H28N3O4PS and a molecular weight of 473.54 g/mol. Its IUPAC name is 2-N-(4-dimethylphosphoryl-2-methoxyphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(4-dimethylphosphoryl-2-methoxyphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 67053387 |
| Molecular Formula | C23H28N3O4PS |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-N-(4-dimethylphosphoryl-2-methoxyphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyridine-2,4-diamine |
| SMILES | COc1cc(P(C)(C)=O)ccc1Nc1cc(Nc2ccccc2S(=O)(=O)C(C)C)ccn1 |
| InChI | InChI=1S/C23H28N3O4PS/c1-16(2)32(28,29)22-9-7-6-8-20(22)25-17-12-13-24-23(14-17)26-19-11-10-18(31(4,5)27)15-21(19)30-3/h6-16H,1-5H3,(H2,24,25,26) |
| InChIKey | SUJPZHWLSRDGPA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|