C23H24Br2N2O2 — CID 15517998
ethyl 4-(6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (PubChem CID 15517998) has the molecular formula C23H24Br2N2O2 and a molecular weight of 520.27 g/mol. Its IUPAC name is ethyl 4-(6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 15517998 |
| Molecular Formula | C23H24Br2N2O2 |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | ethyl 4-(6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=C2c3ncc(Br)cc3CCc3cc(C)cc(Br)c32)CC1 |
| InChI | InChI=1S/C23H24Br2N2O2/c1-3-29-23(28)27-8-6-15(7-9-27)21-20-16(10-14(2)11-19(20)25)4-5-17-12-18(24)13-26-22(17)21/h10-13H,3-9H2,1-2H3 |
| InChIKey | CWJZNNZSBOYKJO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |