C16H26O4 — CID 15518097
(Z)-5-[(4S,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxan-4-yl]pent-4-enoic acid (PubChem CID 15518097) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (Z)-5-[(4S,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxan-4-yl]pent-4-enoic acid.
| Compound Name | (Z)-5-[(4S,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxan-4-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 15518097 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (Z)-5-[(4S,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxan-4-yl]pent-4-enoic acid |
| SMILES | CCCCC/C=C\[C@H]1COCO[C@H]1/C=C\CCC(=O)O |
| InChI | InChI=1S/C16H26O4/c1-2-3-4-5-6-9-14-12-19-13-20-15(14)10-7-8-11-16(17)18/h6-7,9-10,14-15H,2-5,8,11-13H2,1H3,(H,17,18)/b9-6-,10-7-/t14-,15-/m0/s1 |
| InChIKey | RKDRQYZXDMLYSJ-SSFHAOGMSA-N |
| XLogP | 3.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|