C24H21F6NO4 — CID 155181062
ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 155181062) has the molecular formula C24H21F6NO4 and a molecular weight of 501.42 g/mol. Its IUPAC name is ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 155181062 |
| Molecular Formula | C24H21F6NO4 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methoxycarbonylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc2c(c1)CCC2NC(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F6NO4/c1-2-34-21(32)8-4-14-3-6-19-16(9-14)5-7-20(19)31-22(33)35-13-15-10-17(23(25,26)27)12-18(11-15)24(28,29)30/h3-4,6,8-12,20H,2,5,7,13H2,1H3,(H,31,33)/b8-4+ |
| InChIKey | PJTGSRYYHYQQTN-XBXARRHUSA-N |
| XLogP | 6.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|