C18H25BrN2O3 — CID 155181426
N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-hydroxyoctanediamide (PubChem CID 155181426) has the molecular formula C18H25BrN2O3 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-hydroxyoctanediamide.
| Compound Name | N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 155181426 |
| Molecular Formula | C18H25BrN2O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NC1CCCc2cc(Br)ccc21)NO |
| InChI | InChI=1S/C18H25BrN2O3/c19-14-10-11-15-13(12-14)6-5-7-16(15)20-17(22)8-3-1-2-4-9-18(23)21-24/h10-12,16,24H,1-9H2,(H,20,22)(H,21,23) |
| InChIKey | ZCWDHTDQDQEBLB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|