C35H43N3O6 — CID 155182013
[(3S)-7-(methylamino)-2-oxo-3-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl] 2,4,6-trimethylbenzoate (PubChem CID 155182013) has the molecular formula C35H43N3O6 and a molecular weight of 601.74 g/mol. Its IUPAC name is [(3S)-7-(methylamino)-2-oxo-3-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl] 2,4,6-trimethylbenzoate.
| Compound Name | [(3S)-7-(methylamino)-2-oxo-3-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 155182013 |
| Molecular Formula | C35H43N3O6 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | [(3S)-7-(methylamino)-2-oxo-3-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl] 2,4,6-trimethylbenzoate |
| SMILES | CNCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)COC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C35H43N3O6/c1-24-19-25(2)32(26(3)20-24)34(41)43-23-31(39)29(17-11-12-18-36-4)37-33(40)30(21-27-13-7-5-8-14-27)38-35(42)44-22-28-15-9-6-10-16-28/h5-10,13-16,19-20,29-30,36H,11-12,17-18,21-23H2,1-4H3,(H,37,40)(H,38,42)/t29-,30-/m0/s1 |
| InChIKey | GVSWXXVBSNINAT-KYJUHHDHSA-N |
| XLogP | 4.75 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|