C37H43N3O9 — CID 130345425
4-[[7-(2,6-dimethylbenzoyl)oxy-6-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl]amino]-4-oxobutanoic acid (PubChem CID 130345425) has the molecular formula C37H43N3O9 and a molecular weight of 673.76 g/mol. Its IUPAC name is 4-[[7-(2,6-dimethylbenzoyl)oxy-6-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[7-(2,6-dimethylbenzoyl)oxy-6-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130345425 |
| Molecular Formula | C37H43N3O9 |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 4-[[7-(2,6-dimethylbenzoyl)oxy-6-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]heptyl]amino]-4-oxobutanoic acid |
| SMILES | Cc1cccc(C)c1C(=O)OCC(=O)C(CCCCNC(=O)CCC(=O)O)NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H43N3O9/c1-25-12-11-13-26(2)34(25)36(46)48-24-31(41)29(18-9-10-21-38-32(42)19-20-33(43)44)39-35(45)30(22-27-14-5-3-6-15-27)40-37(47)49-23-28-16-7-4-8-17-28/h3-8,11-17,29-30H,9-10,18-24H2,1-2H3,(H,38,42)(H,39,45)(H,40,47)(H,43,44) |
| InChIKey | RAUXFFZJOQNZJD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|