C19H22N4O6 — CID 155183782
(E)-N'-[2-(methoxymethoxymethyl)-6-nitrophenyl]-N-(2-nitrophenyl)but-2-ene-1,4-diamine (PubChem CID 155183782) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is (E)-N'-[2-(methoxymethoxymethyl)-6-nitrophenyl]-N-(2-nitrophenyl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N'-[2-(methoxymethoxymethyl)-6-nitrophenyl]-N-(2-nitrophenyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 155183782 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (E)-N'-[2-(methoxymethoxymethyl)-6-nitrophenyl]-N-(2-nitrophenyl)but-2-ene-1,4-diamine |
| SMILES | COCOCc1cccc([N+](=O)[O-])c1NC/C=C/CNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N4O6/c1-28-14-29-13-15-7-6-10-18(23(26)27)19(15)21-12-5-4-11-20-16-8-2-3-9-17(16)22(24)25/h2-10,20-21H,11-14H2,1H3/b5-4+ |
| InChIKey | QTQUEECPIVHWAZ-SNAWJCMRSA-N |
| XLogP | 3.70 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|