C10H15N3O4 — CID 15518556
(2S)-2-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentanoic acid (PubChem CID 15518556) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S)-2-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentanoic acid.
| Compound Name | (2S)-2-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 15518556 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2S)-2-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)pentanoic acid |
| SMILES | Cc1cn(CCC[C@H](N)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O4/c1-6-5-13(10(17)12-8(6)14)4-2-3-7(11)9(15)16/h5,7H,2-4,11H2,1H3,(H,15,16)(H,12,14,17)/t7-/m0/s1 |
| InChIKey | OGZLDEVWNVXFRA-ZETCQYMHSA-N |
| XLogP | -0.96 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |