C19H17FN2O — CID 155185871
7-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-fluorofluoren-9-one (PubChem CID 155185871) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is 7-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-fluorofluoren-9-one.
| Compound Name | 7-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-fluorofluoren-9-one |
|---|---|
| PubChem CID | 155185871 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 7-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-fluorofluoren-9-one |
| SMILES | O=C1c2cc(N3C[C@H]4CNC[C@H]4C3)ccc2-c2cccc(F)c21 |
| InChI | InChI=1S/C19H17FN2O/c20-17-3-1-2-15-14-5-4-13(6-16(14)19(23)18(15)17)22-9-11-7-21-8-12(11)10-22/h1-6,11-12,21H,7-10H2/t11-,12+ |
| InChIKey | LIRCWVVJMDWSHU-TXEJJXNPSA-N |
| XLogP | 2.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |