C11H13NO2S — CID 15518934
5-(benzenesulfonylmethyl)-3,4-dihydro-2H-pyrrole (PubChem CID 15518934) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(benzenesulfonylmethyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 15518934 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-3,4-dihydro-2H-pyrrole |
| SMILES | O=S(=O)(CC1=NCCC1)c1ccccc1 |
| InChI | InChI=1S/C11H13NO2S/c13-15(14,9-10-5-4-8-12-10)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | MZQRHQIQHZUUES-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |