C18H18N2O2S — CID 13381881
5-(benzenesulfonyl)spiro[benzimidazole-2,1'-cyclohexane] (PubChem CID 13381881) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 5-(benzenesulfonyl)spiro[benzimidazole-2,1'-cyclohexane].
| Compound Name | 5-(benzenesulfonyl)spiro[benzimidazole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 13381881 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 5-(benzenesulfonyl)spiro[benzimidazole-2,1'-cyclohexane] |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)=NC1(CCCCC1)N=2 |
| InChI | InChI=1S/C18H18N2O2S/c21-23(22,14-7-3-1-4-8-14)15-9-10-16-17(13-15)20-18(19-16)11-5-2-6-12-18/h1,3-4,7-10,13H,2,5-6,11-12H2 |
| InChIKey | AJAOGGYRWJXUQI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |