C12H24N2O3 — CID 155190179
tert-butyl N-[(3S,7S)-5-hydroxy-7-methylazepan-3-yl]carbamate (PubChem CID 155190179) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is tert-butyl N-[(3S,7S)-5-hydroxy-7-methylazepan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,7S)-5-hydroxy-7-methylazepan-3-yl]carbamate |
|---|---|
| PubChem CID | 155190179 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | tert-butyl N-[(3S,7S)-5-hydroxy-7-methylazepan-3-yl]carbamate |
| SMILES | C[C@H]1CC(O)C[C@H](NC(=O)OC(C)(C)C)CN1 |
| InChI | InChI=1S/C12H24N2O3/c1-8-5-10(15)6-9(7-13-8)14-11(16)17-12(2,3)4/h8-10,13,15H,5-7H2,1-4H3,(H,14,16)/t8-,9-,10?/m0/s1 |
| InChIKey | AIJOQCCWFPXFRH-XMCUXHSSSA-N |
| XLogP | 1.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |