About 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid
2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid (PubChem CID 155190385) has the molecular formula C14H11Cl2NO3S
and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid |
| PubChem CID | 155190385 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid |
| SMILES | O=C(O)CN=S(=O)(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c15-10-3-1-5-12(7-10)21(20,17-9-14(18)19)13-6-2-4-11(16)8-13/h1-8H,9H2,(H,18,19) |
| InChIKey | KDKRVUZOCUMGOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid?
The IUPAC name of 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid (CID 155190385) is 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid.
What is the SMILES notation for 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid?
The canonical SMILES for 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid is O=C(O)CN=S(=O)(c1cccc(Cl)c1)c1cccc(Cl)c1.
What is the InChIKey of 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid?
The InChIKey is KDKRVUZOCUMGOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2NO3S/c15-10-3-1-5-12(7-10)21(20,17-9-14(18)19)13-6-2-4-11(16)8-13/h1-8H,9H2,(H,18,19).
What are the key properties of 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid?
2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid has a molecular weight of 344.22 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetic acid is sourced from PubChem (CID 155190385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).