About 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate
2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate (PubChem CID 142587793) has the molecular formula C18H19Cl2NO3S
and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate |
| PubChem CID | 142587793 |
| Molecular Formula | C18H19Cl2NO3S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate |
| SMILES | CC(C)COC(=O)CN=S(=O)(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO3S/c1-13(2)12-24-18(22)11-21-25(23,16-7-3-5-14(19)9-16)17-8-4-6-15(20)10-17/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | GEQJHYOPTSKSBZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate?
The IUPAC name of 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate (CID 142587793) is 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate.
What is the SMILES notation for 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate?
The canonical SMILES for 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate is CC(C)COC(=O)CN=S(=O)(c1cccc(Cl)c1)c1cccc(Cl)c1.
What is the InChIKey of 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate?
The InChIKey is GEQJHYOPTSKSBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2NO3S/c1-13(2)12-24-18(22)11-21-25(23,16-7-3-5-14(19)9-16)17-8-4-6-15(20)10-17/h3-10,13H,11-12H2,1-2H3.
What are the key properties of 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate?
2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate has a molecular weight of 400.33 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-[[bis(3-chlorophenyl)-oxo-λ6-sulfanylidene]amino]acetate is sourced from PubChem (CID 142587793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).