C24H25F3N6O2 — CID 155192125
(4S,9aR)-4-methyl-2-(1-methyl-2-oxo-1,8-naphthyridin-4-yl)-N-(3,4,5-trifluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-8-carboxamide (PubChem CID 155192125) has the molecular formula C24H25F3N6O2 and a molecular weight of 486.50 g/mol. Its IUPAC name is (4S,9aR)-4-methyl-2-(1-methyl-2-oxo-1,8-naphthyridin-4-yl)-N-(3,4,5-trifluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-8-carboxamide.
| Compound Name | (4S,9aR)-4-methyl-2-(1-methyl-2-oxo-1,8-naphthyridin-4-yl)-N-(3,4,5-trifluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 155192125 |
| Molecular Formula | C24H25F3N6O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (4S,9aR)-4-methyl-2-(1-methyl-2-oxo-1,8-naphthyridin-4-yl)-N-(3,4,5-trifluorophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-8-carboxamide |
| SMILES | C[C@H]1CN(c2cc(=O)n(C)c3ncccc23)C[C@@H]2CN(C(=O)Nc3cc(F)c(F)c(F)c3)CCN21 |
| InChI | InChI=1S/C24H25F3N6O2/c1-14-11-32(20-10-21(34)30(2)23-17(20)4-3-5-28-23)13-16-12-31(6-7-33(14)16)24(35)29-15-8-18(25)22(27)19(26)9-15/h3-5,8-10,14,16H,6-7,11-13H2,1-2H3,(H,29,35)/t14-,16-/m0/s1 |
| InChIKey | AAQKMKWXCKTKQE-HOCLYGCPSA-N |
| XLogP | 2.78 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|