C16H14F6N4O — CID 97260801
(3R)-3-[5-(trifluoromethyl)pyrazol-1-yl]-N-(3,4,5-trifluorophenyl)piperidine-1-carboxamide (PubChem CID 97260801) has the molecular formula C16H14F6N4O and a molecular weight of 392.30 g/mol. Its IUPAC name is (3R)-3-[5-(trifluoromethyl)pyrazol-1-yl]-N-(3,4,5-trifluorophenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[5-(trifluoromethyl)pyrazol-1-yl]-N-(3,4,5-trifluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97260801 |
| Molecular Formula | C16H14F6N4O |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (3R)-3-[5-(trifluoromethyl)pyrazol-1-yl]-N-(3,4,5-trifluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)N1CCC[C@@H](n2nccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H14F6N4O/c17-11-6-9(7-12(18)14(11)19)24-15(27)25-5-1-2-10(8-25)26-13(3-4-23-26)16(20,21)22/h3-4,6-7,10H,1-2,5,8H2,(H,24,27)/t10-/m1/s1 |
| InChIKey | BZOWFNNFCFRABO-SNVBAGLBSA-N |
| XLogP | 4.19 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|