C18H21NO7 — CID 15519286
triethyl 4-phenyl-2H-1,3-oxazole-2,5,5-tricarboxylate (PubChem CID 15519286) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is triethyl 4-phenyl-2H-1,3-oxazole-2,5,5-tricarboxylate.
| Compound Name | triethyl 4-phenyl-2H-1,3-oxazole-2,5,5-tricarboxylate |
|---|---|
| PubChem CID | 15519286 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | triethyl 4-phenyl-2H-1,3-oxazole-2,5,5-tricarboxylate |
| SMILES | CCOC(=O)C1N=C(c2ccccc2)C(C(=O)OCC)(C(=O)OCC)O1 |
| InChI | InChI=1S/C18H21NO7/c1-4-23-15(20)14-19-13(12-10-8-7-9-11-12)18(26-14,16(21)24-5-2)17(22)25-6-3/h7-11,14H,4-6H2,1-3H3 |
| InChIKey | PAYSYSLDFDFGFT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|