C25H23Cl2N5O3 — CID 155194460
3-[6-[[3-chloro-1-(1-chloropiperidin-4-yl)pyrazol-5-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione (PubChem CID 155194460) has the molecular formula C25H23Cl2N5O3 and a molecular weight of 512.40 g/mol. Its IUPAC name is 3-[6-[[3-chloro-1-(1-chloropiperidin-4-yl)pyrazol-5-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[3-chloro-1-(1-chloropiperidin-4-yl)pyrazol-5-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155194460 |
| Molecular Formula | C25H23Cl2N5O3 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 3-[6-[[3-chloro-1-(1-chloropiperidin-4-yl)pyrazol-5-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Cc5cc(Cl)nn5C5CCN(Cl)CC5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C25H23Cl2N5O3/c26-21-13-16(32(29-21)15-8-10-30(27)11-9-15)12-14-4-5-19-23-17(14)2-1-3-18(23)25(35)31(19)20-6-7-22(33)28-24(20)34/h1-5,13,15,20H,6-12H2,(H,28,33,34) |
| InChIKey | JKUSUQTYVRHKGV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|