C29H32N6O5 — CID 155195319
tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 155195319) has the molecular formula C29H32N6O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155195319 |
| Molecular Formula | C29H32N6O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(Nc3ccc4c5c(cccc35)C(=O)N4C3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C29H32N6O5/c1-29(2,3)40-28(39)33-13-11-18(12-14-33)34-16-17(15-30-34)31-21-7-8-22-25-19(21)5-4-6-20(25)27(38)35(22)23-9-10-24(36)32-26(23)37/h4-8,15-16,18,23,31H,9-14H2,1-3H3,(H,32,36,37) |
| InChIKey | KTKGNHLEAVOZHO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|