C27H32F2N6O4 — CID 138694659
4-[5-[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]piperidin-1-yl]pentyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 138694659) has the molecular formula C27H32F2N6O4 and a molecular weight of 542.59 g/mol. Its IUPAC name is 4-[5-[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]piperidin-1-yl]pentyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[5-[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]piperidin-1-yl]pentyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138694659 |
| Molecular Formula | C27H32F2N6O4 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 4-[5-[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]piperidin-1-yl]pentyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1cn(C2CCN(CCCCCc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)nc1C(F)F |
| InChI | InChI=1S/C27H32F2N6O4/c28-24(29)23-19(30)15-34(32-23)17-10-13-33(14-11-17)12-3-1-2-5-16-6-4-7-18-22(16)27(39)35(26(18)38)20-8-9-21(36)31-25(20)37/h4,6-7,15,17,20,24H,1-3,5,8-14,30H2,(H,31,36,37) |
| InChIKey | BJPQZIAZGJBMJV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|