C21H36N3P — CID 155201396
N-[butyl(tert-butyl)phosphanyl]-1,3-di(propan-2-yl)benzimidazol-2-imine (PubChem CID 155201396) has the molecular formula C21H36N3P and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[butyl(tert-butyl)phosphanyl]-1,3-di(propan-2-yl)benzimidazol-2-imine.
| Compound Name | N-[butyl(tert-butyl)phosphanyl]-1,3-di(propan-2-yl)benzimidazol-2-imine |
|---|---|
| PubChem CID | 155201396 |
| Molecular Formula | C21H36N3P |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N-[butyl(tert-butyl)phosphanyl]-1,3-di(propan-2-yl)benzimidazol-2-imine |
| SMILES | CCCCP(N=c1n(C(C)C)c2ccccc2n1C(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H36N3P/c1-9-10-15-25(21(6,7)8)22-20-23(16(2)3)18-13-11-12-14-19(18)24(20)17(4)5/h11-14,16-17H,9-10,15H2,1-8H3 |
| InChIKey | YYTYGDUJPZKAKP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|