C43H38N4O7 — CID 155204463
4-[[2-[2-(2-hydroxyethoxy)ethylamino]-4-[4-[[4-(4-methoxycarbonylphenyl)benzoyl]amino]phenyl]benzenecarboximidoyl]amino]naphthalene-1-carboxylic acid (PubChem CID 155204463) has the molecular formula C43H38N4O7 and a molecular weight of 722.80 g/mol. Its IUPAC name is 4-[[2-[2-(2-hydroxyethoxy)ethylamino]-4-[4-[[4-(4-methoxycarbonylphenyl)benzoyl]amino]phenyl]benzenecarboximidoyl]amino]naphthalene-1-carboxylic acid.
| Compound Name | 4-[[2-[2-(2-hydroxyethoxy)ethylamino]-4-[4-[[4-(4-methoxycarbonylphenyl)benzoyl]amino]phenyl]benzenecarboximidoyl]amino]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 155204463 |
| Molecular Formula | C43H38N4O7 |
| Molecular Weight | 722.80 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | 4-[[2-[2-(2-hydroxyethoxy)ethylamino]-4-[4-[[4-(4-methoxycarbonylphenyl)benzoyl]amino]phenyl]benzenecarboximidoyl]amino]naphthalene-1-carboxylic acid |
| SMILES | [H]/N=C(/Nc1ccc(C(=O)O)c2ccccc12)c1ccc(-c2ccc(NC(=O)c3ccc(-c4ccc(C(=O)OC)cc4)cc3)cc2)cc1NCCOCCO |
| InChI | InChI=1S/C43H38N4O7/c1-53-43(52)31-12-8-28(9-13-31)27-6-10-30(11-7-27)41(49)46-33-17-14-29(15-18-33)32-16-19-37(39(26-32)45-22-24-54-25-23-48)40(44)47-38-21-20-36(42(50)51)34-4-2-3-5-35(34)38/h2-21,26,45,48H,22-25H2,1H3,(H2,44,47)(H,46,49)(H,50,51) |
| InChIKey | YYBFDWQQSJCDAG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 170.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.80 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|