C39H35N3O5 — CID 164994629
methyl 4-[4-[[4-[4-[[4-(1-hydroxyethenyl)naphthalen-1-yl]carbamoyl]phenyl]phenyl]carbamoyl]phenyl]piperidine-1-carboxylate (PubChem CID 164994629) has the molecular formula C39H35N3O5 and a molecular weight of 625.73 g/mol. Its IUPAC name is methyl 4-[4-[[4-[4-[[4-(1-hydroxyethenyl)naphthalen-1-yl]carbamoyl]phenyl]phenyl]carbamoyl]phenyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[4-[[4-[4-[[4-(1-hydroxyethenyl)naphthalen-1-yl]carbamoyl]phenyl]phenyl]carbamoyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164994629 |
| Molecular Formula | C39H35N3O5 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | methyl 4-[4-[[4-[4-[[4-(1-hydroxyethenyl)naphthalen-1-yl]carbamoyl]phenyl]phenyl]carbamoyl]phenyl]piperidine-1-carboxylate |
| SMILES | C=C(O)c1ccc(NC(=O)c2ccc(-c3ccc(NC(=O)c4ccc(C5CCN(C(=O)OC)CC5)cc4)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C39H35N3O5/c1-25(43)33-19-20-36(35-6-4-3-5-34(33)35)41-38(45)31-13-7-26(8-14-31)28-15-17-32(18-16-28)40-37(44)30-11-9-27(10-12-30)29-21-23-42(24-22-29)39(46)47-2/h3-20,29,43H,1,21-24H2,2H3,(H,40,44)(H,41,45) |
| InChIKey | IIYKIFUJLBGPNJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|