C18H16INO2S — CID 155205051
methyl 4-(1-iodosulfanyl-2,3-dihydro-1-benzazepin-4-yl)benzoate (PubChem CID 155205051) has the molecular formula C18H16INO2S and a molecular weight of 437.30 g/mol. Its IUPAC name is methyl 4-(1-iodosulfanyl-2,3-dihydro-1-benzazepin-4-yl)benzoate.
| Compound Name | methyl 4-(1-iodosulfanyl-2,3-dihydro-1-benzazepin-4-yl)benzoate |
|---|---|
| PubChem CID | 155205051 |
| Molecular Formula | C18H16INO2S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | methyl 4-(1-iodosulfanyl-2,3-dihydro-1-benzazepin-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=Cc3ccccc3N(SI)CC2)cc1 |
| InChI | InChI=1S/C18H16INO2S/c1-22-18(21)14-8-6-13(7-9-14)15-10-11-20(23-19)17-5-3-2-4-16(17)12-15/h2-9,12H,10-11H2,1H3 |
| InChIKey | RMRVHIGTBITWHV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|