C22H31ClO3 — CID 155207137
[(1S,5R,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-6,10,13-trimethyl-4-oxo-7-tricyclo[4.4.3.01,5]tridecanyl] 2-chloroacetate (PubChem CID 155207137) has the molecular formula C22H31ClO3 and a molecular weight of 378.94 g/mol. Its IUPAC name is [(1S,5R,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-6,10,13-trimethyl-4-oxo-7-tricyclo[4.4.3.01,5]tridecanyl] 2-chloroacetate.
| Compound Name | [(1S,5R,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-6,10,13-trimethyl-4-oxo-7-tricyclo[4.4.3.01,5]tridecanyl] 2-chloroacetate |
|---|---|
| PubChem CID | 155207137 |
| Molecular Formula | C22H31ClO3 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1S,5R,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-6,10,13-trimethyl-4-oxo-7-tricyclo[4.4.3.01,5]tridecanyl] 2-chloroacetate |
| SMILES | C=CC(=C)[C@@H]1C[C@@H](OC(=O)CCl)[C@]2(C)C(C)CC[C@]3(CCC(=O)[C@H]32)[C@H]1C |
| InChI | InChI=1S/C22H31ClO3/c1-6-13(2)16-11-18(26-19(25)12-23)21(5)14(3)7-9-22(15(16)4)10-8-17(24)20(21)22/h6,14-16,18,20H,1-2,7-12H2,3-5H3/t14?,15-,16-,18+,20-,21-,22-/m0/s1 |
| InChIKey | SPAPVAVCMBFTSI-JMJXJLMLSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|