C23H33ClO2 — CID 155207162
(1S,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-7-(3-chloroprop-1-en-2-yloxy)-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one (PubChem CID 155207162) has the molecular formula C23H33ClO2 and a molecular weight of 376.97 g/mol. Its IUPAC name is (1S,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-7-(3-chloroprop-1-en-2-yloxy)-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one.
| Compound Name | (1S,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-7-(3-chloroprop-1-en-2-yloxy)-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one |
|---|---|
| PubChem CID | 155207162 |
| Molecular Formula | C23H33ClO2 |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1S,6R,7R,9R,10S)-9-buta-1,3-dien-2-yl-7-(3-chloroprop-1-en-2-yloxy)-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one |
| SMILES | C=CC(=C)[C@@H]1C[C@@H](OC(=C)CCl)[C@]2(C)C(C)CC[C@]3(CCC(=O)C32)[C@H]1C |
| InChI | InChI=1S/C23H33ClO2/c1-7-14(2)18-12-20(26-16(4)13-24)22(6)15(3)8-10-23(17(18)5)11-9-19(25)21(22)23/h7,15,17-18,20-21H,1-2,4,8-13H2,3,5-6H3/t15?,17-,18-,20+,21?,22-,23-/m0/s1 |
| InChIKey | NQHGEHKCSSJDFY-DCPJMSFPSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|