C24H42O5 — CID 142558023
ethane;ethene;(3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-hydroxyacetate (PubChem CID 142558023) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is ethane;ethene;(3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-hydroxyacetate.
| Compound Name | ethane;ethene;(3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-hydroxyacetate |
|---|---|
| PubChem CID | 142558023 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | ethane;ethene;(3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-hydroxyacetate |
| SMILES | C=C.CC.CC1CC(OC(=O)CO)C2(C)C(C)CCC3(CCC(=O)C32)C(C)C1O |
| InChI | InChI=1S/C20H32O5.C2H6.C2H4/c1-11-9-15(25-16(23)10-21)19(4)12(2)5-7-20(13(3)17(11)24)8-6-14(22)18(19)20;2*1-2/h11-13,15,17-18,21,24H,5-10H2,1-4H3;1-2H3;1-2H2 |
| InChIKey | UILDSDXQBDGSEO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|