C22H36O7 — CID 158212654
[(1S,2S,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4-bis(hydroxymethyl)-7,14-dimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate (PubChem CID 158212654) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is [(1S,2S,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4-bis(hydroxymethyl)-7,14-dimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate.
| Compound Name | [(1S,2S,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4-bis(hydroxymethyl)-7,14-dimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 158212654 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [(1S,2S,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-2,4-bis(hydroxymethyl)-7,14-dimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
| SMILES | CC[C@]1(CO)C[C@@H](OC(=O)CO)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C22H36O7/c1-4-21(12-25)9-16(29-17(27)11-24)20(3)13(2)5-7-22(14(10-23)19(21)28)8-6-15(26)18(20)22/h13-14,16,18-19,23-25,28H,4-12H2,1-3H3/t13-,14+,16-,18?,19+,20+,21-,22+/m1/s1 |
| InChIKey | XIZFAOSKZPTJPV-GAUPNRSLSA-N |
| XLogP | 1.05 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |