C38H54O6Si — CID 158102385
[(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-4-(hydroxymethyl)-2,7,14-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[tert-butyl(diphenyl)silyl]oxyacetate (PubChem CID 158102385) has the molecular formula C38H54O6Si and a molecular weight of 634.93 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-4-(hydroxymethyl)-2,7,14-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[tert-butyl(diphenyl)silyl]oxyacetate.
| Compound Name | [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-4-(hydroxymethyl)-2,7,14-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[tert-butyl(diphenyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 158102385 |
| Molecular Formula | C38H54O6Si |
| Molecular Weight | 634.93 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R,14R)-4-ethyl-3-hydroxy-4-(hydroxymethyl)-2,7,14-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[tert-butyl(diphenyl)silyl]oxyacetate |
| SMILES | CC[C@]1(CO)C[C@@H](OC(=O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C38H54O6Si/c1-8-37(25-39)23-31(36(7)26(2)19-21-38(27(3)34(37)42)22-20-30(40)33(36)38)44-32(41)24-43-45(35(4,5)6,28-15-11-9-12-16-28)29-17-13-10-14-18-29/h9-18,26-27,31,33-34,39,42H,8,19-25H2,1-7H3/t26-,27+,31-,33?,34+,36+,37-,38+/m1/s1 |
| InChIKey | CNXDNUZONIJFQN-RCARSTGZSA-N |
| XLogP | 5.67 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|