C32H39F3O6 — CID 168783182
[2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 168783182) has the molecular formula C32H39F3O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is [2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168783182 |
| Molecular Formula | C32H39F3O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | [2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C=CC1(C)C[C@@H](OC(=O)COC(=O)/C=C/c2ccc(C(F)(F)F)cc2)[C@@]2(C)[C@@H]3C(=O)CCC3(CC[C@@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C32H39F3O6/c1-6-29(4)17-24(30(5)19(2)13-15-31(20(3)28(29)39)16-14-23(36)27(30)31)41-26(38)18-40-25(37)12-9-21-7-10-22(11-8-21)32(33,34)35/h6-12,19-20,24,27-28,39H,1,13-18H2,2-5H3/b12-9+/t19-,20-,24+,27-,28-,29?,30-,31?/m0/s1 |
| InChIKey | MXEXZJLWQIDNRQ-LCBDCBLKSA-N |
| XLogP | 6.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|