C32H39NO6 — CID 168783180
[2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-(3-cyanophenyl)prop-2-enoate (PubChem CID 168783180) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is [2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-(3-cyanophenyl)prop-2-enoate.
| Compound Name | [2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-(3-cyanophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 168783180 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | [2-[[(2R,3S,6R,7R,8R,14S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-3-(3-cyanophenyl)prop-2-enoate |
| SMILES | C=CC1(C)C[C@@H](OC(=O)COC(=O)/C=C/c2cccc(C#N)c2)[C@@]2(C)[C@@H]3C(=O)CCC3(CC[C@@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C32H39NO6/c1-6-30(4)17-25(39-27(36)19-38-26(35)11-10-22-8-7-9-23(16-22)18-33)31(5)20(2)12-14-32(21(3)29(30)37)15-13-24(34)28(31)32/h6-11,16,20-21,25,28-29,37H,1,12-15,17,19H2,2-5H3/b11-10+/t20-,21-,25+,28-,29-,30?,31-,32?/m0/s1 |
| InChIKey | QKQXDOMPLRKBMD-ZVQGCZPISA-N |
| XLogP | 5.02 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|