C40H66O6 — CID 102595458
[2-[[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-octadec-9-enoate (PubChem CID 102595458) has the molecular formula C40H66O6 and a molecular weight of 642.96 g/mol. Its IUPAC name is [2-[[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-octadec-9-enoate.
| Compound Name | [2-[[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 102595458 |
| Molecular Formula | C40H66O6 |
| Molecular Weight | 642.96 g/mol |
| Exact Mass | 642.49 |
| IUPAC Name | [2-[[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] (E)-octadec-9-enoate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COC(=O)CCCCCCC/C=C/CCCCCCCC)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C40H66O6/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-34(42)45-29-35(43)46-33-28-38(5,8-2)37(44)31(4)40-26-24-30(3)39(33,6)36(40)32(41)25-27-40/h8,15-16,30-31,33,36-37,44H,2,7,9-14,17-29H2,1,3-6H3/b16-15+/t30-,31+,33-,36+,37+,38-,39+,40+/m1/s1 |
| InChIKey | XYJHBXDYTIIGGT-JEJHTEQMSA-N |
| XLogP | 9.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.96 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|