C26H45N2O5+ — CID 156676321
[(1S,2R,3S,4S,6R,7R,14R)-4-ethyl-3-hydroxy-4,7,14-trimethyl-9-oxo-2-(piperazin-4-ium-1-ylmethyl)-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate (PubChem CID 156676321) has the molecular formula C26H45N2O5+ and a molecular weight of 465.66 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,14R)-4-ethyl-3-hydroxy-4,7,14-trimethyl-9-oxo-2-(piperazin-4-ium-1-ylmethyl)-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethyl-3-hydroxy-4,7,14-trimethyl-9-oxo-2-(piperazin-4-ium-1-ylmethyl)-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 156676321 |
| Molecular Formula | C26H45N2O5+ |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.33 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethyl-3-hydroxy-4,7,14-trimethyl-9-oxo-2-(piperazin-4-ium-1-ylmethyl)-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
| SMILES | CC[C@@]1(C)C[C@@H](OC(=O)CO)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@H](CN2CC[NH2+]CC2)[C@@H]1O |
| InChI | InChI=1S/C26H44N2O5/c1-5-24(3)14-20(33-21(31)16-29)25(4)17(2)6-8-26(9-7-19(30)22(25)26)18(23(24)32)15-28-12-10-27-11-13-28/h17-18,20,22-23,27,29,32H,5-16H2,1-4H3/p+1/t17-,18-,20-,22?,23+,24+,25+,26+/m1/s1 |
| InChIKey | MHXXFKQSXAFDQP-SIPTXPAFSA-O |
| XLogP | 0.97 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |