C15H18O2 — CID 155207613
1-(6-ethyl-1-benzofuran-3-yl)-2,2-dimethylpropan-1-one (PubChem CID 155207613) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(6-ethyl-1-benzofuran-3-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(6-ethyl-1-benzofuran-3-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 155207613 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(6-ethyl-1-benzofuran-3-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCc1ccc2c(C(=O)C(C)(C)C)coc2c1 |
| InChI | InChI=1S/C15H18O2/c1-5-10-6-7-11-12(9-17-13(11)8-10)14(16)15(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | YECWNOQGFRHCHV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |