C13H18N2O4 — CID 155209022
isocyanic acid;2-(2-methylbutan-2-yl)benzene-1,4-diol (PubChem CID 155209022) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is isocyanic acid;2-(2-methylbutan-2-yl)benzene-1,4-diol.
| Compound Name | isocyanic acid;2-(2-methylbutan-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 155209022 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | isocyanic acid;2-(2-methylbutan-2-yl)benzene-1,4-diol |
| SMILES | CCC(C)(C)c1cc(O)ccc1O.N=C=O.N=C=O |
| InChI | InChI=1S/C11H16O2.2CHNO/c1-4-11(2,3)9-7-8(12)5-6-10(9)13;2*2-1-3/h5-7,12-13H,4H2,1-3H3;2*2H |
| InChIKey | ALAOEQFAJRQUIK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|