C25H26F3N3O5 — CID 155212182
2-[[[3-[4-(cyanomethyl)-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]amino]methyl]-4-nitrobenzoic acid (PubChem CID 155212182) has the molecular formula C25H26F3N3O5 and a molecular weight of 505.49 g/mol. Its IUPAC name is 2-[[[3-[4-(cyanomethyl)-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]amino]methyl]-4-nitrobenzoic acid.
| Compound Name | 2-[[[3-[4-(cyanomethyl)-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]amino]methyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 155212182 |
| Molecular Formula | C25H26F3N3O5 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-[[[3-[4-(cyanomethyl)-3-(trifluoromethyl)phenoxy]-2,2,4,4-tetramethylcyclobutyl]amino]methyl]-4-nitrobenzoic acid |
| SMILES | CC1(C)C(NCc2cc([N+](=O)[O-])ccc2C(=O)O)C(C)(C)C1Oc1ccc(CC#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F3N3O5/c1-23(2)21(30-13-15-11-16(31(34)35)6-8-18(15)20(32)33)24(3,4)22(23)36-17-7-5-14(9-10-29)19(12-17)25(26,27)28/h5-8,11-12,21-22,30H,9,13H2,1-4H3,(H,32,33) |
| InChIKey | VMORBFGAEOWPIX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|