About 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol
8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol (PubChem CID 15521437) has the molecular formula C15H24Cl2O3
and a molecular weight of 323.26 g/mol. Its IUPAC name is 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol.
Molecular Properties
| Compound Name | 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol |
| PubChem CID | 15521437 |
| Molecular Formula | C15H24Cl2O3 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol |
| SMILES | CCCCCCCCC1(O)CC2(OCCO2)C(Cl)=C1Cl |
| InChI | InChI=1S/C15H24Cl2O3/c1-2-3-4-5-6-7-8-14(18)11-15(13(17)12(14)16)19-9-10-20-15/h18H,2-11H2,1H3 |
| InChIKey | HHMHQGMQYAQUNP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol?
The IUPAC name of 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol (CID 15521437) is 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol.
What is the SMILES notation for 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol?
The canonical SMILES for 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol is CCCCCCCCC1(O)CC2(OCCO2)C(Cl)=C1Cl.
What is the InChIKey of 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol?
The InChIKey is HHMHQGMQYAQUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24Cl2O3/c1-2-3-4-5-6-7-8-14(18)11-15(13(17)12(14)16)19-9-10-20-15/h18H,2-11H2,1H3.
What are the key properties of 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol?
8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol has a molecular weight of 323.26 g/mol, XLogP of 4.30, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dichloro-7-octyl-1,4-dioxaspiro[4.4]non-8-en-7-ol is sourced from PubChem (CID 15521437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).