C38H40N2O6 — CID 155217553
20-methoxy-6,19-dimethyl-5-phenylmethoxy-13-(phenylmethoxymethyl)-8,10-dioxa-14,23-diazahexacyclo[14.6.2.02,14.04,12.07,11.017,22]tetracosa-4,6,11,17(22),18,20-hexaen-21-ol (PubChem CID 155217553) has the molecular formula C38H40N2O6 and a molecular weight of 620.75 g/mol. Its IUPAC name is 20-methoxy-6,19-dimethyl-5-phenylmethoxy-13-(phenylmethoxymethyl)-8,10-dioxa-14,23-diazahexacyclo[14.6.2.02,14.04,12.07,11.017,22]tetracosa-4,6,11,17(22),18,20-hexaen-21-ol.
| Compound Name | 20-methoxy-6,19-dimethyl-5-phenylmethoxy-13-(phenylmethoxymethyl)-8,10-dioxa-14,23-diazahexacyclo[14.6.2.02,14.04,12.07,11.017,22]tetracosa-4,6,11,17(22),18,20-hexaen-21-ol |
|---|---|
| PubChem CID | 155217553 |
| Molecular Formula | C38H40N2O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 20-methoxy-6,19-dimethyl-5-phenylmethoxy-13-(phenylmethoxymethyl)-8,10-dioxa-14,23-diazahexacyclo[14.6.2.02,14.04,12.07,11.017,22]tetracosa-4,6,11,17(22),18,20-hexaen-21-ol |
| SMILES | COc1c(C)cc2c(c1O)C1NCC2CN2C(COCc3ccccc3)c3c(c(OCc4ccccc4)c(C)c4c3OCO4)CC12 |
| InChI | InChI=1S/C38H40N2O6/c1-22-14-27-26-16-39-33(32(27)34(41)35(22)42-3)29-15-28-31(30(40(29)17-26)20-43-18-24-10-6-4-7-11-24)38-37(45-21-46-38)23(2)36(28)44-19-25-12-8-5-9-13-25/h4-14,26,29-30,33,39,41H,15-21H2,1-3H3 |
| InChIKey | JTURLGLNORMFEG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|