About (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine
(3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine (PubChem CID 15522168) has the molecular formula C21H26N2
and a molecular weight of 306.45 g/mol. Its IUPAC name is (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine.
Molecular Properties
| Compound Name | (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine |
| PubChem CID | 15522168 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine |
| SMILES | C[C@H](c1cccc2ccccc12)N(C)C1=N[C@]1(C)C1CCCC1 |
| InChI | InChI=1S/C21H26N2/c1-15(18-14-8-10-16-9-4-7-13-19(16)18)23(3)20-21(2,22-20)17-11-5-6-12-17/h4,7-10,13-15,17H,5-6,11-12H2,1-3H3/t15-,21-/m1/s1 |
| InChIKey | WVYDBLDJSXLDLL-QVKFZJNVSA-N |
| XLogP | 5.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine?
The IUPAC name of (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine (CID 15522168) is (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine.
What is the SMILES notation for (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine?
The canonical SMILES for (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine is C[C@H](c1cccc2ccccc12)N(C)C1=N[C@]1(C)C1CCCC1.
What is the InChIKey of (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine?
The InChIKey is WVYDBLDJSXLDLL-QVKFZJNVSA-N. The full InChI is InChI=1S/C21H26N2/c1-15(18-14-8-10-16-9-4-7-13-19(16)18)23(3)20-21(2,22-20)17-11-5-6-12-17/h4,7-10,13-15,17H,5-6,11-12H2,1-3H3/t15-,21-/m1/s1.
What are the key properties of (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine?
(3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine has a molecular weight of 306.45 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-cyclopentyl-N,3-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]azirin-2-amine is sourced from PubChem (CID 15522168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).